C20H33FO2S — CID 10066884
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraene-1-sulfonyl fluoride (PubChem CID 10066884) has the molecular formula C20H33FO2S and a molecular weight of 356.55 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraene-1-sulfonyl fluoride.
| Compound Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraene-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 10066884 |
| Molecular Formula | C20H33FO2S |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraene-1-sulfonyl fluoride |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCS(=O)(=O)F |
| InChI | InChI=1S/C20H33FO2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(21,22)23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | FUMBQHYWMFCKTB-DOFZRALJSA-N |
| XLogP | 6.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|