About N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide
N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide (PubChem CID 10066899) has the molecular formula C15H13F2NO3S2
and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide |
| PubChem CID | 10066899 |
| Molecular Formula | C15H13F2NO3S2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide |
| SMILES | CC(=O)c1ccc(Sc2ccc(F)cc2F)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H13F2NO3S2/c1-9(19)10-3-5-15(13(7-10)18-23(2,20)21)22-14-6-4-11(16)8-12(14)17/h3-8,18H,1-2H3 |
| InChIKey | GFQBWBFYGJTLDW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide?
The IUPAC name of N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide (CID 10066899) is N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide.
What is the SMILES notation for N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide?
The canonical SMILES for N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide is CC(=O)c1ccc(Sc2ccc(F)cc2F)c(NS(C)(=O)=O)c1.
What is the InChIKey of N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide?
The InChIKey is GFQBWBFYGJTLDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO3S2/c1-9(19)10-3-5-15(13(7-10)18-23(2,20)21)22-14-6-4-11(16)8-12(14)17/h3-8,18H,1-2H3.
What are the key properties of N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide?
N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide has a molecular weight of 357.40 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide is sourced from PubChem (CID 10066899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).