C22H27FN2O3S — CID 100669260
(3R)-1-(4-fluorophenyl)sulfonyl-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide (PubChem CID 100669260) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100669260 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C22H27FN2O3S/c1-17-5-2-6-18(15-17)7-3-13-24-22(26)19-8-4-14-25(16-19)29(27,28)21-11-9-20(23)10-12-21/h2,5-6,9-12,15,19H,3-4,7-8,13-14,16H2,1H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | BEKZCTVKLCADHU-LJQANCHMSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|