C22H24N4O — CID 10067088
2-[5-[3-(3-benzyl-1,2,4-oxadiazol-5-yl)propyl]-1H-indol-3-yl]ethanamine (PubChem CID 10067088) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[5-[3-(3-benzyl-1,2,4-oxadiazol-5-yl)propyl]-1H-indol-3-yl]ethanamine.
| Compound Name | 2-[5-[3-(3-benzyl-1,2,4-oxadiazol-5-yl)propyl]-1H-indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 10067088 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[5-[3-(3-benzyl-1,2,4-oxadiazol-5-yl)propyl]-1H-indol-3-yl]ethanamine |
| SMILES | NCCc1c[nH]c2ccc(CCCc3nc(Cc4ccccc4)no3)cc12 |
| InChI | InChI=1S/C22H24N4O/c23-12-11-18-15-24-20-10-9-17(13-19(18)20)7-4-8-22-25-21(26-27-22)14-16-5-2-1-3-6-16/h1-3,5-6,9-10,13,15,24H,4,7-8,11-12,14,23H2 |
| InChIKey | JTBDYCCVUAQYMO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |