C14H17N7 — CID 100670955
N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)-N'-pyridin-2-ylpropane-1,3-diamine (PubChem CID 100670955) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)-N'-pyridin-2-ylpropane-1,3-diamine.
| Compound Name | N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)-N'-pyridin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 100670955 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)-N'-pyridin-2-ylpropane-1,3-diamine |
| SMILES | Cc1nc2ccc(NCCCNc3ccccn3)nn2n1 |
| InChI | InChI=1S/C14H17N7/c1-11-18-14-7-6-13(20-21(14)19-11)17-10-4-9-16-12-5-2-3-8-15-12/h2-3,5-8H,4,9-10H2,1H3,(H,15,16)(H,17,20) |
| InChIKey | ANUGUNFKGKXBNL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|