C16H25N7O — CID 100671048
4-N-butyl-6-[(3S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidine-2,4-diamine (PubChem CID 100671048) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-N-butyl-6-[(3S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-[(3S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 100671048 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 4-N-butyl-6-[(3S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(N2CCC[C@H](c3nc(C)no3)C2)nc(N)n1 |
| InChI | InChI=1S/C16H25N7O/c1-3-4-7-18-13-9-14(21-16(17)20-13)23-8-5-6-12(10-23)15-19-11(2)22-24-15/h9,12H,3-8,10H2,1-2H3,(H3,17,18,20,21)/t12-/m0/s1 |
| InChIKey | AAUPRBJIGQUELG-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|