C18H22FN3O4 — CID 100671105
tert-butyl 5-[[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyrazine-2-carboxylate (PubChem CID 100671105) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is tert-butyl 5-[[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyrazine-2-carboxylate.
| Compound Name | tert-butyl 5-[[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 100671105 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl 5-[[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cnc(NC[C@@H](O)COc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C18H22FN3O4/c1-18(2,3)26-17(24)15-9-22-16(10-20-15)21-8-13(23)11-25-14-6-4-12(19)5-7-14/h4-7,9-10,13,23H,8,11H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | WUEQBNAAOZDVRH-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |