About trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane
trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane (PubChem CID 10067134) has the molecular formula C14H24NSi+
and a molecular weight of 234.44 g/mol. Its IUPAC name is trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane |
| PubChem CID | 10067134 |
| Molecular Formula | C14H24NSi+ |
| Molecular Weight | 234.44 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane |
| SMILES | C[N+]1(C[Si](C)(C)C)CCc2ccccc2C1 |
| InChI | InChI=1S/C14H24NSi/c1-15(12-16(2,3)4)10-9-13-7-5-6-8-14(13)11-15/h5-8H,9-12H2,1-4H3/q+1 |
| InChIKey | AMESMMCBTJOSAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane?
The IUPAC name of trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane (CID 10067134) is trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane.
What is the SMILES notation for trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane?
The canonical SMILES for trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane is C[N+]1(C[Si](C)(C)C)CCc2ccccc2C1.
What is the InChIKey of trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane?
The InChIKey is AMESMMCBTJOSAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24NSi/c1-15(12-16(2,3)4)10-9-13-7-5-6-8-14(13)11-15/h5-8H,9-12H2,1-4H3/q+1.
What are the key properties of trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane?
trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane has a molecular weight of 234.44 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)methyl]silane is sourced from PubChem (CID 10067134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).