C12H15N2O7PS — CID 10067187
[(3aR,4R,6R,6aR)-4-(4-cyano-1,3-thiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 10067187) has the molecular formula C12H15N2O7PS and a molecular weight of 362.30 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(4-cyano-1,3-thiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(4-cyano-1,3-thiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10067187 |
| Molecular Formula | C12H15N2O7PS |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(4-cyano-1,3-thiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COP(=O)(O)O)O[C@H]2c1nc(C#N)cs1 |
| InChI | InChI=1S/C12H15N2O7PS/c1-12(2)20-8-7(4-18-22(15,16)17)19-10(9(8)21-12)11-14-6(3-13)5-23-11/h5,7-10H,4H2,1-2H3,(H2,15,16,17)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | LJRGTMCDSAJOHY-ZYUZMQFOSA-N |
| XLogP | 1.08 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|