About 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine
1-(3,3-diethoxypropyl)-2,3-dimethylguanidine (PubChem CID 100673098) has the molecular formula C10H23N3O2
and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine |
| PubChem CID | 100673098 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine |
| SMILES | CCOC(CCN/C(=N/C)NC)OCC |
| InChI | InChI=1S/C10H23N3O2/c1-5-14-9(15-6-2)7-8-13-10(11-3)12-4/h9H,5-8H2,1-4H3,(H2,11,12,13) |
| InChIKey | WSILXHKZFIGJHN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine?
The IUPAC name of 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine (CID 100673098) is 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine?
The canonical SMILES for 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine is CCOC(CCN/C(=N/C)NC)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine?
The InChIKey is WSILXHKZFIGJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2/c1-5-14-9(15-6-2)7-8-13-10(11-3)12-4/h9H,5-8H2,1-4H3,(H2,11,12,13).
What are the key properties of 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine?
1-(3,3-diethoxypropyl)-2,3-dimethylguanidine has a molecular weight of 217.31 g/mol, XLogP of 0.57, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-2,3-dimethylguanidine is sourced from PubChem (CID 100673098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).