C13H21F4NO2 — CID 100673737
9-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-6-oxa-9-azaspiro[4.5]decane (PubChem CID 100673737) has the molecular formula C13H21F4NO2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 9-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-6-oxa-9-azaspiro[4.5]decane.
| Compound Name | 9-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-6-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 100673737 |
| Molecular Formula | C13H21F4NO2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 9-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-6-oxa-9-azaspiro[4.5]decane |
| SMILES | FC(F)C(F)(F)COCCN1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C13H21F4NO2/c14-11(15)13(16,17)10-19-7-5-18-6-8-20-12(9-18)3-1-2-4-12/h11H,1-10H2 |
| InChIKey | KSWFZTMWTSQSRD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|