C17H16BrN3O3S — CID 100675315
3-[(2S)-2-(4-bromophenyl)morpholin-4-yl]-4-cyanobenzenesulfonamide (PubChem CID 100675315) has the molecular formula C17H16BrN3O3S and a molecular weight of 422.30 g/mol. Its IUPAC name is 3-[(2S)-2-(4-bromophenyl)morpholin-4-yl]-4-cyanobenzenesulfonamide.
| Compound Name | 3-[(2S)-2-(4-bromophenyl)morpholin-4-yl]-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 100675315 |
| Molecular Formula | C17H16BrN3O3S |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 3-[(2S)-2-(4-bromophenyl)morpholin-4-yl]-4-cyanobenzenesulfonamide |
| SMILES | N#Cc1ccc(S(N)(=O)=O)cc1N1CCO[C@@H](c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H16BrN3O3S/c18-14-4-1-12(2-5-14)17-11-21(7-8-24-17)16-9-15(25(20,22)23)6-3-13(16)10-19/h1-6,9,17H,7-8,11H2,(H2,20,22,23)/t17-/m1/s1 |
| InChIKey | WZRFYJHNXVDMDV-QGZVFWFLSA-N |
| XLogP | 2.55 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |