C22H25NO4 — CID 10067541
9,11-dimethoxy-2-propyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinoline-8,12-diol (PubChem CID 10067541) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 9,11-dimethoxy-2-propyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinoline-8,12-diol.
| Compound Name | 9,11-dimethoxy-2-propyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinoline-8,12-diol |
|---|---|
| PubChem CID | 10067541 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 9,11-dimethoxy-2-propyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinoline-8,12-diol |
| SMILES | CCCN1CCc2c(c(O)c(OC)c3c2ccc2cc(O)c(OC)cc23)C1 |
| InChI | InChI=1S/C22H25NO4/c1-4-8-23-9-7-14-15-6-5-13-10-18(24)19(26-2)11-16(13)20(15)22(27-3)21(25)17(14)12-23/h5-6,10-11,24-25H,4,7-9,12H2,1-3H3 |
| InChIKey | IFMOVFFRZLWNFZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|