C17H21NO4S2 — CID 10067553
S-(3-sulfanylpropyl) 4-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-4-oxobutanethioate (PubChem CID 10067553) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is S-(3-sulfanylpropyl) 4-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-4-oxobutanethioate.
| Compound Name | S-(3-sulfanylpropyl) 4-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-4-oxobutanethioate |
|---|---|
| PubChem CID | 10067553 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | S-(3-sulfanylpropyl) 4-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-4-oxobutanethioate |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OC(=O)N1C(=O)CCC(=O)SCCCS |
| InChI | InChI=1S/C17H21NO4S2/c1-12-16(13-6-3-2-4-7-13)22-17(21)18(12)14(19)8-9-15(20)24-11-5-10-23/h2-4,6-7,12,16,23H,5,8-11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | NJTVQVLBZZBXHD-MLGOLLRUSA-N |
| XLogP | 3.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|