C22H24O5 — CID 10067601
ethyl (4aS,7aR)-7a-hydroxy-3,3-diphenyl-4,5,6,7-tetrahydrocyclopenta[c][1,2]dioxine-4a-carboxylate (PubChem CID 10067601) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl (4aS,7aR)-7a-hydroxy-3,3-diphenyl-4,5,6,7-tetrahydrocyclopenta[c][1,2]dioxine-4a-carboxylate.
| Compound Name | ethyl (4aS,7aR)-7a-hydroxy-3,3-diphenyl-4,5,6,7-tetrahydrocyclopenta[c][1,2]dioxine-4a-carboxylate |
|---|---|
| PubChem CID | 10067601 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | ethyl (4aS,7aR)-7a-hydroxy-3,3-diphenyl-4,5,6,7-tetrahydrocyclopenta[c][1,2]dioxine-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC[C@@]1(O)OOC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C22H24O5/c1-2-25-19(23)20-14-9-15-22(20,24)27-26-21(16-20,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,24H,2,9,14-16H2,1H3/t20-,22-/m1/s1 |
| InChIKey | NGFYVQOXBBZUKG-IFMALSPDSA-N |
| XLogP | 3.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|