C21H26N3O3+ — CID 10067609
[(3R,3aS,8bS)-3-hydroxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-(2-methylphenyl)carbamate (PubChem CID 10067609) has the molecular formula C21H26N3O3+ and a molecular weight of 368.46 g/mol. Its IUPAC name is [(3R,3aS,8bS)-3-hydroxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-(2-methylphenyl)carbamate.
| Compound Name | [(3R,3aS,8bS)-3-hydroxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-(2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 10067609 |
| Molecular Formula | C21H26N3O3+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(3R,3aS,8bS)-3-hydroxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-(2-methylphenyl)carbamate |
| SMILES | Cc1ccccc1NC(=O)Oc1ccc2c(c1)[C@]1(C)CC[N@@+](C)(O)[C@@H]1N2C |
| InChI | InChI=1S/C21H25N3O3/c1-14-7-5-6-8-17(14)22-20(25)27-15-9-10-18-16(13-15)21(2)11-12-24(4,26)19(21)23(18)3/h5-10,13,19,26H,11-12H2,1-4H3/p+1/t19-,21-,24+/m0/s1 |
| InChIKey | LMOGTSBPJOKDHW-ZCVJKFOLSA-O |
| XLogP | 3.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|