C13H20N2O3 — CID 100676834
5-(oxan-4-yl)-3-[[(2S)-oxan-2-yl]methyl]-1,2,4-oxadiazole (PubChem CID 100676834) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(oxan-4-yl)-3-[[(2S)-oxan-2-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(oxan-4-yl)-3-[[(2S)-oxan-2-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 100676834 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 5-(oxan-4-yl)-3-[[(2S)-oxan-2-yl]methyl]-1,2,4-oxadiazole |
| SMILES | C1CC[C@@H](Cc2noc(C3CCOCC3)n2)OC1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-6-17-11(3-1)9-12-14-13(18-15-12)10-4-7-16-8-5-10/h10-11H,1-9H2/t11-/m0/s1 |
| InChIKey | GJVPMJUMTQESET-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |