C14H17N3O3 — CID 100677618
N-[1-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]cyclohexyl]acetamide (PubChem CID 100677618) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[1-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]cyclohexyl]acetamide.
| Compound Name | N-[1-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 100677618 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[1-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1(c2noc(-c3ccoc3)n2)CCCCC1 |
| InChI | InChI=1S/C14H17N3O3/c1-10(18)16-14(6-3-2-4-7-14)13-15-12(20-17-13)11-5-8-19-9-11/h5,8-9H,2-4,6-7H2,1H3,(H,16,18) |
| InChIKey | PVURRBJTKZIQQC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |