C19H34O5Si — CID 10067774
[(1R,6R)-6-(acetyloxymethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]methyl acetate (PubChem CID 10067774) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(1R,6R)-6-(acetyloxymethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1R,6R)-6-(acetyloxymethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10067774 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [(1R,6R)-6-(acetyloxymethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC(CO[Si](C)(C)C(C)(C)C)=CC[C@H]1COC(C)=O |
| InChI | InChI=1S/C19H34O5Si/c1-14(20)22-12-17-9-8-16(10-18(17)13-23-15(2)21)11-24-25(6,7)19(3,4)5/h8,17-18H,9-13H2,1-7H3/t17-,18-/m0/s1 |
| InChIKey | VQUYVIHSECJBFK-ROUUACIJSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|