C31H37BrFN3O4S — CID 100679721
N-[(4-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)butanamide (PubChem CID 100679721) has the molecular formula C31H37BrFN3O4S and a molecular weight of 646.62 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100679721 |
| Molecular Formula | C31H37BrFN3O4S |
| Molecular Weight | 646.62 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CCCN(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C31H37BrFN3O4S/c1-3-4-20-34-31(38)29(22-24-11-6-5-7-12-24)35(23-25-16-18-26(32)19-17-25)30(37)15-10-21-36(41(2,39)40)28-14-9-8-13-27(28)33/h5-9,11-14,16-19,29H,3-4,10,15,20-23H2,1-2H3,(H,34,38)/t29-/m0/s1 |
| InChIKey | CCUSBCQRXPRCIU-LJAQVGFWSA-N |
| XLogP | 5.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|