C16H19ClF3N3O2S — CID 100680658
3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 100680658) has the molecular formula C16H19ClF3N3O2S and a molecular weight of 409.86 g/mol. Its IUPAC name is 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 100680658 |
| Molecular Formula | C16H19ClF3N3O2S |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | CC(C)N(CCCOC(=O)/C=C/c1c(Cl)nc2sccn12)CC(F)(F)F |
| InChI | InChI=1S/C16H19ClF3N3O2S/c1-11(2)22(10-16(18,19)20)6-3-8-25-13(24)5-4-12-14(17)21-15-23(12)7-9-26-15/h4-5,7,9,11H,3,6,8,10H2,1-2H3/b5-4+ |
| InChIKey | HZTIJZXCRSUVAH-SNAWJCMRSA-N |
| XLogP | 4.27 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|