About (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide
(2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide (PubChem CID 100680844) has the molecular formula C14H17Cl2NO4
and a molecular weight of 334.20 g/mol. Its IUPAC name is (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide.
Molecular Properties
| Compound Name | (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide |
| PubChem CID | 100680844 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide |
| SMILES | O=C(N[C@]1(CCO)CCOC1)[C@H](O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO4/c15-10-5-9(6-11(16)7-10)12(19)13(20)17-14(1-3-18)2-4-21-8-14/h5-7,12,18-19H,1-4,8H2,(H,17,20)/t12-,14-/m1/s1 |
| InChIKey | UVMFRXFVAJVNFE-TZMCWYRMSA-N |
| XLogP | 1.68 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide?
The IUPAC name of (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide (CID 100680844) is (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide.
What is the SMILES notation for (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide?
The canonical SMILES for (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide is O=C(N[C@]1(CCO)CCOC1)[C@H](O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide?
The InChIKey is UVMFRXFVAJVNFE-TZMCWYRMSA-N. The full InChI is InChI=1S/C14H17Cl2NO4/c15-10-5-9(6-11(16)7-10)12(19)13(20)17-14(1-3-18)2-4-21-8-14/h5-7,12,18-19H,1-4,8H2,(H,17,20)/t12-,14-/m1/s1.
What are the key properties of (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide?
(2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide has a molecular weight of 334.20 g/mol, XLogP of 1.68, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]acetamide is sourced from PubChem (CID 100680844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).