C17H14ClN3O3S — CID 10068087
ethyl 5-[2-(2-chloro-4-pyridinyl)-1,3-thiazol-4-yl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 10068087) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is ethyl 5-[2-(2-chloro-4-pyridinyl)-1,3-thiazol-4-yl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 5-[2-(2-chloro-4-pyridinyl)-1,3-thiazol-4-yl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10068087 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | ethyl 5-[2-(2-chloro-4-pyridinyl)-1,3-thiazol-4-yl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2csc(-c3ccnc(Cl)c3)n2)c(=O)[nH]c1C |
| InChI | InChI=1S/C17H14ClN3O3S/c1-3-24-17(23)11-7-12(15(22)20-9(11)2)13-8-25-16(21-13)10-4-5-19-14(18)6-10/h4-8H,3H2,1-2H3,(H,20,22) |
| InChIKey | FTQZKKZJHPMZQD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|