C15H20O7S2 — CID 10068114
[(1S,3R,5S,7S)-3-(4-methylphenyl)sulfonyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl methanesulfonate (PubChem CID 10068114) has the molecular formula C15H20O7S2 and a molecular weight of 376.45 g/mol. Its IUPAC name is [(1S,3R,5S,7S)-3-(4-methylphenyl)sulfonyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl methanesulfonate.
| Compound Name | [(1S,3R,5S,7S)-3-(4-methylphenyl)sulfonyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10068114 |
| Molecular Formula | C15H20O7S2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(1S,3R,5S,7S)-3-(4-methylphenyl)sulfonyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C[C@@H]3O[C@@H](COS(C)(=O)=O)[C@H](C2)O3)cc1 |
| InChI | InChI=1S/C15H20O7S2/c1-10-3-5-11(6-4-10)24(18,19)12-7-13-14(9-20-23(2,16)17)22-15(8-12)21-13/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | MLRXAYRLJJVADA-QPSCCSFWSA-N |
| XLogP | 1.02 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|