C17H27N3O — CID 100681162
(2S)-N-(cyclohexylmethyl)-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 100681162) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-N-(cyclohexylmethyl)-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(cyclohexylmethyl)-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 100681162 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (2S)-N-(cyclohexylmethyl)-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1)[C@@H]1CCCN1Cc1ccc[nH]1 |
| InChI | InChI=1S/C17H27N3O/c21-17(19-12-14-6-2-1-3-7-14)16-9-5-11-20(16)13-15-8-4-10-18-15/h4,8,10,14,16,18H,1-3,5-7,9,11-13H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | WEQVVJHNHPRLFH-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |