C22H34O5 — CID 10068236
[(3R,4aR,6R,6aS,10S,10aS,10bR)-3-ethenyl-10-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate (PubChem CID 10068236) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(3R,4aR,6R,6aS,10S,10aS,10bR)-3-ethenyl-10-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate.
| Compound Name | [(3R,4aR,6R,6aS,10S,10aS,10bR)-3-ethenyl-10-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate |
|---|---|
| PubChem CID | 10068236 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(3R,4aR,6R,6aS,10S,10aS,10bR)-3-ethenyl-10-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@H]2[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](OC(C)=O)C[C@@]2(C)O1 |
| InChI | InChI=1S/C22H34O5/c1-8-20(5)11-14(24)17-21(6,27-20)12-15(26-13(2)23)18-19(3,4)10-9-16(25)22(17,18)7/h8,15-18,25H,1,9-12H2,2-7H3/t15-,16+,17+,18+,20+,21-,22-/m1/s1 |
| InChIKey | WGDVDWPPNILGMG-GJLUKNDPSA-N |
| XLogP | 3.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|