C20H16N4O2S — CID 100682947
1,1-diphenyl-3-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]urea (PubChem CID 100682947) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 1,1-diphenyl-3-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]urea.
| Compound Name | 1,1-diphenyl-3-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 100682947 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1,1-diphenyl-3-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]urea |
| SMILES | O=C(NCc1noc(-c2cccs2)n1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N4O2S/c25-20(21-14-18-22-19(26-23-18)17-12-7-13-27-17)24(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13H,14H2,(H,21,25) |
| InChIKey | MJXRUUNJUNUKAN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |