C29H32Cl3N3O4S — CID 100683401
(2R)-N-butyl-2-[[2-(2-chloro-N-methylsulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100683401) has the molecular formula C29H32Cl3N3O4S and a molecular weight of 625.02 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2-chloro-N-methylsulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2-chloro-N-methylsulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100683401 |
| Molecular Formula | C29H32Cl3N3O4S |
| Molecular Weight | 625.02 g/mol |
| Exact Mass | 623.12 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2-chloro-N-methylsulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C29H32Cl3N3O4S/c1-3-4-16-33-29(37)27(17-21-10-6-5-7-11-21)34(19-22-14-15-23(30)18-25(22)32)28(36)20-35(40(2,38)39)26-13-9-8-12-24(26)31/h5-15,18,27H,3-4,16-17,19-20H2,1-2H3,(H,33,37)/t27-/m1/s1 |
| InChIKey | ZBTDGPJCUJQBQD-HHHXNRCGSA-N |
| XLogP | 5.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|