C16H23ClFN3O — CID 100683786
3-[[(1R)-1-(2-chloro-6-fluorophenyl)ethyl]amino]-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 100683786) has the molecular formula C16H23ClFN3O and a molecular weight of 327.83 g/mol. Its IUPAC name is 3-[[(1R)-1-(2-chloro-6-fluorophenyl)ethyl]amino]-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[[(1R)-1-(2-chloro-6-fluorophenyl)ethyl]amino]-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 100683786 |
| Molecular Formula | C16H23ClFN3O |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-[[(1R)-1-(2-chloro-6-fluorophenyl)ethyl]amino]-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | C[C@@H](NCCC(=O)N1CCN(C)CC1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H23ClFN3O/c1-12(16-13(17)4-3-5-14(16)18)19-7-6-15(22)21-10-8-20(2)9-11-21/h3-5,12,19H,6-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | IAOBZQXZUGPDJH-GFCCVEGCSA-N |
| XLogP | 2.29 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |