C22H27FN2O2S — CID 100683880
(2S)-2-[(2-benzylsulfanylacetyl)-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide (PubChem CID 100683880) has the molecular formula C22H27FN2O2S and a molecular weight of 402.54 g/mol. Its IUPAC name is (2S)-2-[(2-benzylsulfanylacetyl)-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[(2-benzylsulfanylacetyl)-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100683880 |
| Molecular Formula | C22H27FN2O2S |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-2-[(2-benzylsulfanylacetyl)-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](C)N(Cc1ccc(F)cc1)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C22H27FN2O2S/c1-16(2)24-22(27)17(3)25(13-18-9-11-20(23)12-10-18)21(26)15-28-14-19-7-5-4-6-8-19/h4-12,16-17H,13-15H2,1-3H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | CPNTVOAQTGDDQP-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |