C17H25F3O6 — CID 10068455
(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-ol (PubChem CID 10068455) has the molecular formula C17H25F3O6 and a molecular weight of 382.38 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-ol.
| Compound Name | (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-ol |
|---|---|
| PubChem CID | 10068455 |
| Molecular Formula | C17H25F3O6 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-ol |
| SMILES | C[C@@H]1CC[C@H]2[C@@](C)(O)[C@@H](OCC(F)(F)F)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C17H25F3O6/c1-9-4-5-11-15(3,21)12(22-8-16(18,19)20)23-13-17(11)10(9)6-7-14(2,24-13)25-26-17/h9-13,21H,4-8H2,1-3H3/t9-,10+,11+,12+,13-,14-,15-,17-/m1/s1 |
| InChIKey | LDFCALDHKZTKRF-NVBIBLTLSA-N |
| XLogP | 2.89 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|