C27H29FN4O6S — CID 100685205
(2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide (PubChem CID 100685205) has the molecular formula C27H29FN4O6S and a molecular weight of 556.62 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100685205 |
| Molecular Formula | C27H29FN4O6S |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](C)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29FN4O6S/c1-19(2)29-27(34)20(3)30(17-21-9-11-22(28)12-10-21)26(33)18-31(23-13-15-24(16-14-23)32(35)36)39(37,38)25-7-5-4-6-8-25/h4-16,19-20H,17-18H2,1-3H3,(H,29,34)/t20-/m0/s1 |
| InChIKey | HXLFLPCAUHZYJK-FQEVSTJZSA-N |
| XLogP | 3.87 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|