C21H16N6O2 — CID 10068578
4,6-diphenoxy-N-[(E)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine (PubChem CID 10068578) has the molecular formula C21H16N6O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 4,6-diphenoxy-N-[(E)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-diphenoxy-N-[(E)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 10068578 |
| Molecular Formula | C21H16N6O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4,6-diphenoxy-N-[(E)-pyridin-3-ylmethylideneamino]-1,3,5-triazin-2-amine |
| SMILES | C(=N/Nc1nc(Oc2ccccc2)nc(Oc2ccccc2)n1)\c1cccnc1 |
| InChI | InChI=1S/C21H16N6O2/c1-3-9-17(10-4-1)28-20-24-19(27-23-15-16-8-7-13-22-14-16)25-21(26-20)29-18-11-5-2-6-12-18/h1-15H,(H,24,25,26,27)/b23-15+ |
| InChIKey | PMLWEDCGEBVQJQ-HZHRSRAPSA-N |
| XLogP | 4.30 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|