C27H31N5OS — CID 100686250
3-[(4R,5R)-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide (PubChem CID 100686250) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is 3-[(4R,5R)-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide.
| Compound Name | 3-[(4R,5R)-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100686250 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 3-[(4R,5R)-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccn(C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C27H31N5OS/c1-19-9-11-21(12-10-19)29-24(33)14-17-32-26(20-13-16-31(18-20)22-6-2-3-7-22)25(30-27(32)34)23-8-4-5-15-28-23/h4-5,8-13,15-16,18,22,25-26H,2-3,6-7,14,17H2,1H3,(H,29,33)(H,30,34)/t25-,26+/m0/s1 |
| InChIKey | ADXKIMHWTBFDLV-IZZNHLLZSA-N |
| XLogP | 5.31 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|