About (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one
(2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one (PubChem CID 100687514) has the molecular formula C16H25N3O3S
and a molecular weight of 339.46 g/mol. Its IUPAC name is (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one.
Molecular Properties
| Compound Name | (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one |
| PubChem CID | 100687514 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one |
| SMILES | C[C@@H](C(=O)N1CCC(N2CCS(=O)(=O)CC2)CC1)n1cccc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-14(17-6-2-3-7-17)16(20)19-8-4-15(5-9-19)18-10-12-23(21,22)13-11-18/h2-3,6-7,14-15H,4-5,8-13H2,1H3/t14-/m0/s1 |
| InChIKey | WMYJCXMRVSFTGG-AWEZNQCLSA-N |
| XLogP | 0.77 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one?
The IUPAC name of (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one (CID 100687514) is (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one.
What is the SMILES notation for (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one?
The canonical SMILES for (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one is C[C@@H](C(=O)N1CCC(N2CCS(=O)(=O)CC2)CC1)n1cccc1.
What is the InChIKey of (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one?
The InChIKey is WMYJCXMRVSFTGG-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H25N3O3S/c1-14(17-6-2-3-7-17)16(20)19-8-4-15(5-9-19)18-10-12-23(21,22)13-11-18/h2-3,6-7,14-15H,4-5,8-13H2,1H3/t14-/m0/s1.
What are the key properties of (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one?
(2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one has a molecular weight of 339.46 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-pyrrol-1-ylpropan-1-one is sourced from PubChem (CID 100687514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).