About 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide
3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide (PubChem CID 10068819) has the molecular formula C22H29NO3S
and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide |
| PubChem CID | 10068819 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide |
| SMILES | CCCCN(C)C(=O)CCSC(Cc1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-3-4-14-23(2)22(26)13-15-27-21(18-7-11-20(25)12-8-18)16-17-5-9-19(24)10-6-17/h5-12,21,24-25H,3-4,13-16H2,1-2H3 |
| InChIKey | IQAXROZGKIITDK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide?
The IUPAC name of 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide (CID 10068819) is 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide.
What is the SMILES notation for 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide?
The canonical SMILES for 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide is CCCCN(C)C(=O)CCSC(Cc1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide?
The InChIKey is IQAXROZGKIITDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO3S/c1-3-4-14-23(2)22(26)13-15-27-21(18-7-11-20(25)12-8-18)16-17-5-9-19(24)10-6-17/h5-12,21,24-25H,3-4,13-16H2,1-2H3.
What are the key properties of 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide?
3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide has a molecular weight of 387.55 g/mol, XLogP of 4.76, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylpropanamide is sourced from PubChem (CID 10068819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).