C36H39Cl2N3O6S — CID 100690114
(2S)-2-[[2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100690114) has the molecular formula C36H39Cl2N3O6S and a molecular weight of 712.70 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100690114 |
| Molecular Formula | C36H39Cl2N3O6S |
| Molecular Weight | 712.70 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H39Cl2N3O6S/c1-4-5-20-39-36(43)32(22-26-12-8-6-9-13-26)40(24-27-16-18-30(37)31(38)21-27)35(42)25-41(48(44,45)29-14-10-7-11-15-29)28-17-19-33(46-2)34(23-28)47-3/h6-19,21,23,32H,4-5,20,22,24-25H2,1-3H3,(H,39,43)/t32-/m0/s1 |
| InChIKey | FSXYIEUQFYOJKA-YTTGMZPUSA-N |
| XLogP | 6.76 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|