C15H25N3O3 — CID 100690427
1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(2S)-1-morpholin-4-yl-1-oxobutan-2-yl]urea (PubChem CID 100690427) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(2S)-1-morpholin-4-yl-1-oxobutan-2-yl]urea.
| Compound Name | 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(2S)-1-morpholin-4-yl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 100690427 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(2S)-1-morpholin-4-yl-1-oxobutan-2-yl]urea |
| SMILES | C#C[C@H](NC(=O)N[C@@H](CC)C(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-5-12(11(3)4)16-15(20)17-13(6-2)14(19)18-7-9-21-10-8-18/h1,11-13H,6-10H2,2-4H3,(H2,16,17,20)/t12-,13-/m0/s1 |
| InChIKey | ITPBPEPBRCZZLC-STQMWFEESA-N |
| XLogP | 0.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|