C16H25N3O2 — CID 100690716
1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2R,5R)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone (PubChem CID 100690716) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2R,5R)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone.
| Compound Name | 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2R,5R)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100690716 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl-[(2R,5R)-5-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CC[C@@H](CO)CN1C(=O)c1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C16H25N3O2/c1-11-7-8-12(10-20)9-19(11)16(21)15-13-5-3-2-4-6-14(13)17-18-15/h11-12,20H,2-10H2,1H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | BLMYVKPQUOVNKQ-VXGBXAGGSA-N |
| XLogP | 1.91 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |