C22H35NO5 — CID 10069163
3-[2-(3-hydroxypropyl)-4-methoxy-5-(3-piperidin-1-ylpropoxy)phenoxy]butan-2-one (PubChem CID 10069163) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropyl)-4-methoxy-5-(3-piperidin-1-ylpropoxy)phenoxy]butan-2-one.
| Compound Name | 3-[2-(3-hydroxypropyl)-4-methoxy-5-(3-piperidin-1-ylpropoxy)phenoxy]butan-2-one |
|---|---|
| PubChem CID | 10069163 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 3-[2-(3-hydroxypropyl)-4-methoxy-5-(3-piperidin-1-ylpropoxy)phenoxy]butan-2-one |
| SMILES | COc1cc(CCCO)c(OC(C)C(C)=O)cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C22H35NO5/c1-17(25)18(2)28-20-16-22(21(26-3)15-19(20)9-7-13-24)27-14-8-12-23-10-5-4-6-11-23/h15-16,18,24H,4-14H2,1-3H3 |
| InChIKey | QSTKLZOMMNXBRK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|