About [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate
[1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate (PubChem CID 100693457) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate.
Molecular Properties
| Compound Name | [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate |
| PubChem CID | 100693457 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(=O)N[C@@H](C)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H23NO4/c1-11(18-16(20)17(3,4)22-12(2)19)9-13-5-6-15-14(10-13)7-8-21-15/h5-6,10-11H,7-9H2,1-4H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | MKWFADJMBBNJAP-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate?
The IUPAC name of [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate (CID 100693457) is [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate.
What is the SMILES notation for [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate?
The canonical SMILES for [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate is CC(=O)OC(C)(C)C(=O)N[C@@H](C)Cc1ccc2c(c1)CCO2.
What is the InChIKey of [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate?
The InChIKey is MKWFADJMBBNJAP-NSHDSACASA-N. The full InChI is InChI=1S/C17H23NO4/c1-11(18-16(20)17(3,4)22-12(2)19)9-13-5-6-15-14(10-13)7-8-21-15/h5-6,10-11H,7-9H2,1-4H3,(H,18,20)/t11-/m0/s1.
What are the key properties of [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate?
[1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate has a molecular weight of 305.37 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(2S)-1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-yl]amino]-2-methyl-1-oxopropan-2-yl] acetate is sourced from PubChem (CID 100693457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).