C14H13Cl2F3N4O2 — CID 10069357
N-(diaminomethylidene)-2-[(1S)-5,6-dichloro-3-oxo-2-(3,3,3-trifluoropropyl)-1H-isoindol-1-yl]acetamide (PubChem CID 10069357) has the molecular formula C14H13Cl2F3N4O2 and a molecular weight of 397.18 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-[(1S)-5,6-dichloro-3-oxo-2-(3,3,3-trifluoropropyl)-1H-isoindol-1-yl]acetamide.
| Compound Name | N-(diaminomethylidene)-2-[(1S)-5,6-dichloro-3-oxo-2-(3,3,3-trifluoropropyl)-1H-isoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 10069357 |
| Molecular Formula | C14H13Cl2F3N4O2 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-(diaminomethylidene)-2-[(1S)-5,6-dichloro-3-oxo-2-(3,3,3-trifluoropropyl)-1H-isoindol-1-yl]acetamide |
| SMILES | NC(N)=NC(=O)C[C@H]1c2cc(Cl)c(Cl)cc2C(=O)N1CCC(F)(F)F |
| InChI | InChI=1S/C14H13Cl2F3N4O2/c15-8-3-6-7(4-9(8)16)12(25)23(2-1-14(17,18)19)10(6)5-11(24)22-13(20)21/h3-4,10H,1-2,5H2,(H4,20,21,22,24)/t10-/m0/s1 |
| InChIKey | DGUHPWFNINYIJH-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|