C19H21ClN2O2 — CID 100693749
(4-chlorophenyl)-[4-[3-(hydroxymethyl)anilino]piperidin-1-yl]methanone (PubChem CID 100693749) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[3-(hydroxymethyl)anilino]piperidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[3-(hydroxymethyl)anilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100693749 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4-chlorophenyl)-[4-[3-(hydroxymethyl)anilino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC(Nc2cccc(CO)c2)CC1 |
| InChI | InChI=1S/C19H21ClN2O2/c20-16-6-4-15(5-7-16)19(24)22-10-8-17(9-11-22)21-18-3-1-2-14(12-18)13-23/h1-7,12,17,21,23H,8-11,13H2 |
| InChIKey | YVVLLEDYWDPXLJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |