C26H25N3O4 — CID 1006938
(3R)-N-[2-(benzylcarbamoyl)phenyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 1006938) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is (3R)-N-[2-(benzylcarbamoyl)phenyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(benzylcarbamoyl)phenyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 1006938 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (3R)-N-[2-(benzylcarbamoyl)phenyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@H](C(=O)Nc3ccccc3C(=O)NCc3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-33-21-13-11-20(12-14-21)29-17-19(15-24(29)30)25(31)28-23-10-6-5-9-22(23)26(32)27-16-18-7-3-2-4-8-18/h2-14,19H,15-17H2,1H3,(H,27,32)(H,28,31)/t19-/m1/s1 |
| InChIKey | JSZLWQGELWALLZ-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |