About 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid
9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid (PubChem CID 10069787) has the molecular formula C25H28N2O3
and a molecular weight of 404.51 g/mol. Its IUPAC name is 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid.
Molecular Properties
| Compound Name | 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid |
| PubChem CID | 10069787 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid |
| SMILES | O=C(O)CCCCCCCCOc1ncc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28N2O3/c28-23(29)17-11-3-1-2-4-12-18-30-25-26-19-22(20-13-7-5-8-14-20)24(27-25)21-15-9-6-10-16-21/h5-10,13-16,19H,1-4,11-12,17-18H2,(H,28,29) |
| InChIKey | NZFGYBHULCRIHN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid?
The IUPAC name of 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid (CID 10069787) is 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid.
What is the SMILES notation for 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid?
The canonical SMILES for 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid is O=C(O)CCCCCCCCOc1ncc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid?
The InChIKey is NZFGYBHULCRIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O3/c28-23(29)17-11-3-1-2-4-12-18-30-25-26-19-22(20-13-7-5-8-14-20)24(27-25)21-15-9-6-10-16-21/h5-10,13-16,19H,1-4,11-12,17-18H2,(H,28,29).
What are the key properties of 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid?
9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid has a molecular weight of 404.51 g/mol, XLogP of 6.00, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4,5-diphenylpyrimidin-2-yl)oxynonanoic acid is sourced from PubChem (CID 10069787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).