C36H39Cl2N3O4S — CID 100698560
(2R)-2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100698560) has the molecular formula C36H39Cl2N3O4S and a molecular weight of 680.70 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100698560 |
| Molecular Formula | C36H39Cl2N3O4S |
| Molecular Weight | 680.70 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-2,5-dimethylanilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H39Cl2N3O4S/c1-4-5-21-39-36(43)34(23-28-13-8-6-9-14-28)40(24-30-31(37)17-12-18-32(30)38)35(42)25-41(33-22-26(2)19-20-27(33)3)46(44,45)29-15-10-7-11-16-29/h6-20,22,34H,4-5,21,23-25H2,1-3H3,(H,39,43)/t34-/m1/s1 |
| InChIKey | HUKTYQOLKOUWMU-UUWRZZSWSA-N |
| XLogP | 7.36 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|