About 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine
5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 10069967) has the molecular formula C22H21N3O3S
and a molecular weight of 407.50 g/mol. Its IUPAC name is 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 10069967 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cc2nc(NCc3cccnc3)sc2c(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-26-18-11-17-21(29-22(25-17)24-13-16-9-6-10-23-12-16)20(27-2)19(18)28-14-15-7-4-3-5-8-15/h3-12H,13-14H2,1-2H3,(H,24,25) |
| InChIKey | TTXQSROYSAPNPF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine?
The IUPAC name of 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine (CID 10069967) is 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine is COc1cc2nc(NCc3cccnc3)sc2c(OC)c1OCc1ccccc1.
What is the InChIKey of 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine?
The InChIKey is TTXQSROYSAPNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3S/c1-26-18-11-17-21(29-22(25-17)24-13-16-9-6-10-23-12-16)20(27-2)19(18)28-14-15-7-4-3-5-8-15/h3-12H,13-14H2,1-2H3,(H,24,25).
What are the key properties of 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine?
5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine has a molecular weight of 407.50 g/mol, XLogP of 4.90, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-6-phenylmethoxy-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 10069967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).