C17H16FN3O2 — CID 100700326
1-[(1S)-1-(5-fluoro-1-benzofuran-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 100700326) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-[(1S)-1-(5-fluoro-1-benzofuran-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[(1S)-1-(5-fluoro-1-benzofuran-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 100700326 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[(1S)-1-(5-fluoro-1-benzofuran-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | C[C@H](NC(=O)NCc1ccncc1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H16FN3O2/c1-11(16-9-13-8-14(18)2-3-15(13)23-16)21-17(22)20-10-12-4-6-19-7-5-12/h2-9,11H,10H2,1H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | GDXHMLSAPCRRHX-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |