C18H33FN2O5S — CID 10070038
(2S)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-propylpyrrolidine-2-carboxamide (PubChem CID 10070038) has the molecular formula C18H33FN2O5S and a molecular weight of 408.54 g/mol. Its IUPAC name is (2S)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10070038 |
| Molecular Formula | C18H33FN2O5S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2S)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-propylpyrrolidine-2-carboxamide |
| SMILES | CCCC1(F)CN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C18H33FN2O5S/c1-5-6-18(19)7-10(20-8-18)16(25)21-11(9(2)3)15-13(23)12(22)14(24)17(26-15)27-4/h9-15,17,20,22-24H,5-8H2,1-4H3,(H,21,25)/t10-,11+,12-,13+,14+,15+,17+,18?/m0/s1 |
| InChIKey | QSWMXBBKOQVGOX-BDLLNJPBSA-N |
| XLogP | 0.17 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |