C16H16F6N4O2 — CID 10070118
N-(diaminomethylidene)-2-[3-oxo-2-(4,4,4-trifluorobutyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide (PubChem CID 10070118) has the molecular formula C16H16F6N4O2 and a molecular weight of 410.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-[3-oxo-2-(4,4,4-trifluorobutyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide.
| Compound Name | N-(diaminomethylidene)-2-[3-oxo-2-(4,4,4-trifluorobutyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 10070118 |
| Molecular Formula | C16H16F6N4O2 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-(diaminomethylidene)-2-[3-oxo-2-(4,4,4-trifluorobutyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide |
| SMILES | NC(N)=NC(=O)CC1c2cc(C(F)(F)F)ccc2C(=O)N1CCCC(F)(F)F |
| InChI | InChI=1S/C16H16F6N4O2/c17-15(18,19)4-1-5-26-11(7-12(27)25-14(23)24)10-6-8(16(20,21)22)2-3-9(10)13(26)28/h2-3,6,11H,1,4-5,7H2,(H4,23,24,25,27) |
| InChIKey | GKWZHVINSZTHMU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|